C23H24N6OS — CID 4732078
[5-(1-propylbenzimidazol-2-yl)thiophen-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 4732078) has the molecular formula C23H24N6OS and a molecular weight of 432.55 g/mol. Its IUPAC name is [5-(1-propylbenzimidazol-2-yl)thiophen-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-(1-propylbenzimidazol-2-yl)thiophen-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4732078 |
| Molecular Formula | C23H24N6OS |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [5-(1-propylbenzimidazol-2-yl)thiophen-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | CCCn1c(-c2ccc(C(=O)N3CCN(c4ncccn4)CC3)s2)nc2ccccc21 |
| InChI | InChI=1S/C23H24N6OS/c1-2-12-29-18-7-4-3-6-17(18)26-21(29)19-8-9-20(31-19)22(30)27-13-15-28(16-14-27)23-24-10-5-11-25-23/h3-11H,2,12-16H2,1H3 |
| InChIKey | XBNTZQKUROCTBI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |