C21H17N5O4S — CID 4731945
5-(1-ethylbenzimidazol-2-yl)-N'-(2-nitrobenzoyl)thiophene-2-carbohydrazide (PubChem CID 4731945) has the molecular formula C21H17N5O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 5-(1-ethylbenzimidazol-2-yl)-N'-(2-nitrobenzoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(1-ethylbenzimidazol-2-yl)-N'-(2-nitrobenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4731945 |
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 5-(1-ethylbenzimidazol-2-yl)-N'-(2-nitrobenzoyl)thiophene-2-carbohydrazide |
| SMILES | CCn1c(-c2ccc(C(=O)NNC(=O)c3ccccc3[N+](=O)[O-])s2)nc2ccccc21 |
| InChI | InChI=1S/C21H17N5O4S/c1-2-25-16-10-6-4-8-14(16)22-19(25)17-11-12-18(31-17)21(28)24-23-20(27)13-7-3-5-9-15(13)26(29)30/h3-12H,2H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | WECLVLPEUZBVPI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|