C20H15N5O4S — CID 4731815
5-(1-methylbenzimidazol-2-yl)-N'-(3-nitrobenzoyl)thiophene-2-carbohydrazide (PubChem CID 4731815) has the molecular formula C20H15N5O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is 5-(1-methylbenzimidazol-2-yl)-N'-(3-nitrobenzoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-(1-methylbenzimidazol-2-yl)-N'-(3-nitrobenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4731815 |
| Molecular Formula | C20H15N5O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 5-(1-methylbenzimidazol-2-yl)-N'-(3-nitrobenzoyl)thiophene-2-carbohydrazide |
| SMILES | Cn1c(-c2ccc(C(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)s2)nc2ccccc21 |
| InChI | InChI=1S/C20H15N5O4S/c1-24-15-8-3-2-7-14(15)21-18(24)16-9-10-17(30-16)20(27)23-22-19(26)12-5-4-6-13(11-12)25(28)29/h2-11H,1H3,(H,22,26)(H,23,27) |
| InChIKey | DPDXLKYJPWHLJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|