C11H10BrN3O3S2 — CID 47336082
ethyl N-[[2-(4-bromothiophen-2-yl)-1,3-thiazole-4-carbonyl]amino]carbamate (PubChem CID 47336082) has the molecular formula C11H10BrN3O3S2 and a molecular weight of 376.26 g/mol. Its IUPAC name is ethyl N-[[2-(4-bromothiophen-2-yl)-1,3-thiazole-4-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[2-(4-bromothiophen-2-yl)-1,3-thiazole-4-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 47336082 |
| Molecular Formula | C11H10BrN3O3S2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | ethyl N-[[2-(4-bromothiophen-2-yl)-1,3-thiazole-4-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1csc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C11H10BrN3O3S2/c1-2-18-11(17)15-14-9(16)7-5-20-10(13-7)8-3-6(12)4-19-8/h3-5H,2H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | VZACZDPFOQKBQC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|