C10H15N3OS — CID 47350091
3-(1,3-thiazol-4-ylmethylamino)azepan-2-one (PubChem CID 47350091) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethylamino)azepan-2-one.
| Compound Name | 3-(1,3-thiazol-4-ylmethylamino)azepan-2-one |
|---|---|
| PubChem CID | 47350091 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethylamino)azepan-2-one |
| SMILES | O=C1NCCCCC1NCc1cscn1 |
| InChI | InChI=1S/C10H15N3OS/c14-10-9(3-1-2-4-11-10)12-5-8-6-15-7-13-8/h6-7,9,12H,1-5H2,(H,11,14) |
| InChIKey | TXLQQOHHJXQWSU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |