C11H19N5O2 — CID 66268661
3-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]azepan-2-one (PubChem CID 66268661) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]azepan-2-one.
| Compound Name | 3-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]azepan-2-one |
|---|---|
| PubChem CID | 66268661 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 3-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]azepan-2-one |
| SMILES | O=C1NCCCCC1NCc1cn(CCO)nn1 |
| InChI | InChI=1S/C11H19N5O2/c17-6-5-16-8-9(14-15-16)7-13-10-3-1-2-4-12-11(10)18/h8,10,13,17H,1-7H2,(H,12,18) |
| InChIKey | HPZCGJHCKIJSFT-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |