C16H13FN2O2S — CID 4735989
3-benzyl-5-(3-fluoroanilino)-1,3-thiazolidine-2,4-dione (PubChem CID 4735989) has the molecular formula C16H13FN2O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-benzyl-5-(3-fluoroanilino)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-(3-fluoroanilino)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4735989 |
| Molecular Formula | C16H13FN2O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3-benzyl-5-(3-fluoroanilino)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(Nc2cccc(F)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H13FN2O2S/c17-12-7-4-8-13(9-12)18-14-15(20)19(16(21)22-14)10-11-5-2-1-3-6-11/h1-9,14,18H,10H2 |
| InChIKey | AHSMQKXQNNWZFI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|