C10H14BrN3O2S — CID 47364291
2-[[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]-methylamino]acetamide (PubChem CID 47364291) has the molecular formula C10H14BrN3O2S and a molecular weight of 320.21 g/mol. Its IUPAC name is 2-[[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | 2-[[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 47364291 |
| Molecular Formula | C10H14BrN3O2S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-[[2-[(4-bromothiophen-2-yl)methylamino]-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(N)=O)CC(=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H14BrN3O2S/c1-14(4-9(12)15)5-10(16)13-3-8-2-7(11)6-17-8/h2,6H,3-5H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | HTRABDDSQQOGHE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |