C16H22BrN3O3S — CID 154706726
N-[2-[(3-bromothiophen-2-yl)methyl-(2-morpholin-4-ylethyl)amino]-2-oxoethyl]prop-2-enamide (PubChem CID 154706726) has the molecular formula C16H22BrN3O3S and a molecular weight of 416.34 g/mol. Its IUPAC name is N-[2-[(3-bromothiophen-2-yl)methyl-(2-morpholin-4-ylethyl)amino]-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-[(3-bromothiophen-2-yl)methyl-(2-morpholin-4-ylethyl)amino]-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 154706726 |
| Molecular Formula | C16H22BrN3O3S |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | N-[2-[(3-bromothiophen-2-yl)methyl-(2-morpholin-4-ylethyl)amino]-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N(CCN1CCOCC1)Cc1sccc1Br |
| InChI | InChI=1S/C16H22BrN3O3S/c1-2-15(21)18-11-16(22)20(12-14-13(17)3-10-24-14)5-4-19-6-8-23-9-7-19/h2-3,10H,1,4-9,11-12H2,(H,18,21) |
| InChIKey | XEAVKHSQVBLCGW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|