C10H13BrN2O2S — CID 78983752
N-[(3-bromothiophen-2-yl)methyl]morpholine-4-carboxamide (PubChem CID 78983752) has the molecular formula C10H13BrN2O2S and a molecular weight of 305.20 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]morpholine-4-carboxamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 78983752 |
| Molecular Formula | C10H13BrN2O2S |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCc1sccc1Br)N1CCOCC1 |
| InChI | InChI=1S/C10H13BrN2O2S/c11-8-1-6-16-9(8)7-12-10(14)13-2-4-15-5-3-13/h1,6H,2-5,7H2,(H,12,14) |
| InChIKey | HYOVRWRVWJILMH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |