C12H19BrN2S — CID 63207619
N-[(3-bromothiophen-2-yl)methyl]-N-methyl-2-pyrrolidin-1-ylethanamine (PubChem CID 63207619) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-N-methyl-2-pyrrolidin-1-ylethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-N-methyl-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 63207619 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-N-methyl-2-pyrrolidin-1-ylethanamine |
| SMILES | CN(CCN1CCCC1)Cc1sccc1Br |
| InChI | InChI=1S/C12H19BrN2S/c1-14(7-8-15-5-2-3-6-15)10-12-11(13)4-9-16-12/h4,9H,2-3,5-8,10H2,1H3 |
| InChIKey | CVEOXVXSRDBHMK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |