C9H14BrNS — CID 48542145
N-[(3-bromothiophen-2-yl)methyl]-N-methylpropan-1-amine (PubChem CID 48542145) has the molecular formula C9H14BrNS and a molecular weight of 248.19 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-N-methylpropan-1-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 48542145 |
| Molecular Formula | C9H14BrNS |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-N-methylpropan-1-amine |
| SMILES | CCCN(C)Cc1sccc1Br |
| InChI | InChI=1S/C9H14BrNS/c1-3-5-11(2)7-9-8(10)4-6-12-9/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | DSGAIFHJYNHQNZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |