C12H18BrNS — CID 55211598
N-[(3-bromothiophen-2-yl)methyl]-1-cyclopentyl-N-methylmethanamine (PubChem CID 55211598) has the molecular formula C12H18BrNS and a molecular weight of 288.25 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-1-cyclopentyl-N-methylmethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-1-cyclopentyl-N-methylmethanamine |
|---|---|
| PubChem CID | 55211598 |
| Molecular Formula | C12H18BrNS |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-1-cyclopentyl-N-methylmethanamine |
| SMILES | CN(Cc1sccc1Br)CC1CCCC1 |
| InChI | InChI=1S/C12H18BrNS/c1-14(8-10-4-2-3-5-10)9-12-11(13)6-7-15-12/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | SIDNBNUUFDHMLA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |