C9H12ClN5O2S — CID 47364480
5-chloro-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide (PubChem CID 47364480) has the molecular formula C9H12ClN5O2S and a molecular weight of 289.75 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 47364480 |
| Molecular Formula | C9H12ClN5O2S |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-chloro-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2ncn(C)c2Cl)cn1 |
| InChI | InChI=1S/C9H12ClN5O2S/c1-14-6-11-9(8(14)10)18(16,17)13-4-7-3-12-15(2)5-7/h3,5-6,13H,4H2,1-2H3 |
| InChIKey | INXFYVOKQKKJOG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |