C15H10N2O4S2 — CID 4737582
N-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-hydroxybenzamide (PubChem CID 4737582) has the molecular formula C15H10N2O4S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-hydroxybenzamide.
| Compound Name | N-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 4737582 |
| Molecular Formula | C15H10N2O4S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-[5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-hydroxybenzamide |
| SMILES | O=C(NN1C(=O)C(=Cc2ccco2)SC1=S)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H10N2O4S2/c18-10-5-3-9(4-6-10)13(19)16-17-14(20)12(23-15(17)22)8-11-2-1-7-21-11/h1-8,18H,(H,16,19) |
| InChIKey | ZCKKDIBIXXYBEJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|