C26H17N5O3S — CID 4737790
3-[[4-(2-oxochromen-3-yl)-1-phenylimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 4737790) has the molecular formula C26H17N5O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is 3-[[4-(2-oxochromen-3-yl)-1-phenylimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[[4-(2-oxochromen-3-yl)-1-phenylimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 4737790 |
| Molecular Formula | C26H17N5O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 3-[[4-(2-oxochromen-3-yl)-1-phenylimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=c1oc2ccccc2cc1-c1cn(-c2ccccc2)c(SCn2nnc3ccccc3c2=O)n1 |
| InChI | InChI=1S/C26H17N5O3S/c32-24-19-11-5-6-12-21(19)28-29-31(24)16-35-26-27-22(15-30(26)18-9-2-1-3-10-18)20-14-17-8-4-7-13-23(17)34-25(20)33/h1-15H,16H2 |
| InChIKey | OOYXYYWMVRLLCF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 95.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|