C9H11ClN2O2 — CID 47377989
3-chloro-6-ethoxy-N-methylpyridine-2-carboxamide (PubChem CID 47377989) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 3-chloro-6-ethoxy-N-methylpyridine-2-carboxamide.
| Compound Name | 3-chloro-6-ethoxy-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 47377989 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-chloro-6-ethoxy-N-methylpyridine-2-carboxamide |
| SMILES | CCOc1ccc(Cl)c(C(=O)NC)n1 |
| InChI | InChI=1S/C9H11ClN2O2/c1-3-14-7-5-4-6(10)8(12-7)9(13)11-2/h4-5H,3H2,1-2H3,(H,11,13) |
| InChIKey | JWSNLAIJOXQNPD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |