C18H20ClN3O4 — CID 48503176
3-chloro-6-ethoxy-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 48503176) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is 3-chloro-6-ethoxy-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-ethoxy-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 48503176 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-chloro-6-ethoxy-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CCOc1ccc(Cl)c(C(=O)NCC(=O)NCc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C18H20ClN3O4/c1-3-26-16-9-8-14(19)17(22-16)18(24)21-11-15(23)20-10-12-4-6-13(25-2)7-5-12/h4-9H,3,10-11H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | HLYBNPAEBRYNRX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |