C13H20BrN3O2S — CID 47384629
4-bromo-1-methyl-N'-[2-(3-methylbutylsulfanyl)acetyl]pyrrole-2-carbohydrazide (PubChem CID 47384629) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[2-(3-methylbutylsulfanyl)acetyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[2-(3-methylbutylsulfanyl)acetyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 47384629 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 4-bromo-1-methyl-N'-[2-(3-methylbutylsulfanyl)acetyl]pyrrole-2-carbohydrazide |
| SMILES | CC(C)CCSCC(=O)NNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C13H20BrN3O2S/c1-9(2)4-5-20-8-12(18)15-16-13(19)11-6-10(14)7-17(11)3/h6-7,9H,4-5,8H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | RTXHTISRHUYESE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|