C11H10Br2N2OS — CID 47389226
4-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide (PubChem CID 47389226) has the molecular formula C11H10Br2N2OS and a molecular weight of 378.09 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 47389226 |
| Molecular Formula | C11H10Br2N2OS |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | 4-bromo-N-[(5-bromothiophen-3-yl)methyl]-N-methyl-1H-pyrrole-2-carboxamide |
| SMILES | CN(Cc1csc(Br)c1)C(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H10Br2N2OS/c1-15(5-7-2-10(13)17-6-7)11(16)9-3-8(12)4-14-9/h2-4,6,14H,5H2,1H3 |
| InChIKey | VWKAPEVGDQUTSN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |