C21H16N2O3S — CID 4739453
3-methoxy-4-(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde (PubChem CID 4739453) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-methoxy-4-(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde.
| Compound Name | 3-methoxy-4-(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 4739453 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-methoxy-4-(6-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1Oc1ncnc2sc(C)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H16N2O3S/c1-13-18(15-6-4-3-5-7-15)19-20(22-12-23-21(19)27-13)26-16-9-8-14(11-24)10-17(16)25-2/h3-12H,1-2H3 |
| InChIKey | YGUVPSPATQEACX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|