C10H19N3O3S — CID 47399491
1-Cyclopropyl-3-(1-methylsulfonylpiperidin-3-yl)urea (PubChem CID 47399491) has the molecular formula C10H19N3O3S and a molecular weight of 261.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1-methylsulfonylpiperidin-3-yl)urea.
| Compound Name | 1-Cyclopropyl-3-(1-methylsulfonylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 47399491 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 1-cyclopropyl-3-(1-methylsulfonylpiperidin-3-yl)urea |
| SMILES | CS(=O)(=O)N1CCCC(C1)NC(=O)NC2CC2 |
| InChI | InChI=1S/C10H19N3O3S/c1-17(15,16)13-6-2-3-9(7-13)12-10(14)11-8-4-5-8/h8-9H,2-7H2,1H3,(H2,11,12,14) |
| InChIKey | LOXKUDGMPOSVTH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 386 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |