C9H16F3N3O3S — CID 47400180
1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47400180) has the molecular formula C9H16F3N3O3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47400180 |
| Molecular Formula | C9H16F3N3O3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N3O3S/c1-19(17,18)15-4-2-3-7(5-15)14-8(16)13-6-9(10,11)12/h7H,2-6H2,1H3,(H2,13,14,16) |
| InChIKey | LTVBIAWWUIAXOZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |