C19H30N4O2 — CID 4740571
5-[4-[1-(2,4-dimethylphenyl)ethyl]piperazin-1-yl]-5-oxopentanehydrazide (PubChem CID 4740571) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 5-[4-[1-(2,4-dimethylphenyl)ethyl]piperazin-1-yl]-5-oxopentanehydrazide.
| Compound Name | 5-[4-[1-(2,4-dimethylphenyl)ethyl]piperazin-1-yl]-5-oxopentanehydrazide |
|---|---|
| PubChem CID | 4740571 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 5-[4-[1-(2,4-dimethylphenyl)ethyl]piperazin-1-yl]-5-oxopentanehydrazide |
| SMILES | Cc1ccc(C(C)N2CCN(C(=O)CCCC(=O)NN)CC2)c(C)c1 |
| InChI | InChI=1S/C19H30N4O2/c1-14-7-8-17(15(2)13-14)16(3)22-9-11-23(12-10-22)19(25)6-4-5-18(24)21-20/h7-8,13,16H,4-6,9-12,20H2,1-3H3,(H,21,24) |
| InChIKey | MYKNXOINNMJICA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|