C13H19BrN2O3S — CID 47407367
methyl N-[1-[(5-bromothiophen-2-yl)methylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 47407367) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is methyl N-[1-[(5-bromothiophen-2-yl)methylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | methyl N-[1-[(5-bromothiophen-2-yl)methylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 47407367 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | methyl N-[1-[(5-bromothiophen-2-yl)methylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | COC(=O)NC(CC(C)C)C(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-8(2)6-10(16-13(18)19-3)12(17)15-7-9-4-5-11(14)20-9/h4-5,8,10H,6-7H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | IFEDVUZXKYIPLU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |