C12H13N3O5 — CID 47443157
N'-(3-nitrobenzoyl)oxolane-3-carbohydrazide (PubChem CID 47443157) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is N'-(3-nitrobenzoyl)oxolane-3-carbohydrazide.
| Compound Name | N'-(3-nitrobenzoyl)oxolane-3-carbohydrazide |
|---|---|
| PubChem CID | 47443157 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N'-(3-nitrobenzoyl)oxolane-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCOC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O5/c16-11(8-2-1-3-10(6-8)15(18)19)13-14-12(17)9-4-5-20-7-9/h1-3,6,9H,4-5,7H2,(H,13,16)(H,14,17) |
| InChIKey | YXBXAVKMWUWMKG-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|