About N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide
N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide (PubChem CID 47444330) has the molecular formula C13H16F2N2O2
and a molecular weight of 270.28 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide |
| PubChem CID | 47444330 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide |
| SMILES | CN(C)c1c(F)cc(NC(=O)C2CCOC2)cc1F |
| InChI | InChI=1S/C13H16F2N2O2/c1-17(2)12-10(14)5-9(6-11(12)15)16-13(18)8-3-4-19-7-8/h5-6,8H,3-4,7H2,1-2H3,(H,16,18) |
| InChIKey | WXJARGAVBOSARM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide?
The IUPAC name of N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide (CID 47444330) is N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide.
What is the SMILES notation for N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide?
The canonical SMILES for N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide is CN(C)c1c(F)cc(NC(=O)C2CCOC2)cc1F.
What is the InChIKey of N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide?
The InChIKey is WXJARGAVBOSARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O2/c1-17(2)12-10(14)5-9(6-11(12)15)16-13(18)8-3-4-19-7-8/h5-6,8H,3-4,7H2,1-2H3,(H,16,18).
What are the key properties of N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide?
N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide has a molecular weight of 270.28 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(dimethylamino)-3,5-difluorophenyl]oxolane-3-carboxamide is sourced from PubChem (CID 47444330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).