C13H25N3O4 — CID 47452025
tert-butyl N-[(2R)-1-[[2-(ethylamino)-2-oxoethyl]-methylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 47452025) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[2-(ethylamino)-2-oxoethyl]-methylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[2-(ethylamino)-2-oxoethyl]-methylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 47452025 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[2-(ethylamino)-2-oxoethyl]-methylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCNC(=O)CN(C)C(=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-7-14-10(17)8-16(6)11(18)9(2)15-12(19)20-13(3,4)5/h9H,7-8H2,1-6H3,(H,14,17)(H,15,19)/t9-/m1/s1 |
| InChIKey | HQXJRJLZACLYQH-SECBINFHSA-N |
| XLogP | 0.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |