C11H22N4O3S — CID 59191155
tert-butyl N-[(2R)-1-[2-(ethylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 59191155) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-(ethylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-(ethylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59191155 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-(ethylcarbamothioyl)hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | CCNC(=S)NNC(=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O3S/c1-6-12-9(19)15-14-8(16)7(2)13-10(17)18-11(3,4)5/h7H,6H2,1-5H3,(H,13,17)(H,14,16)(H2,12,15,19)/t7-/m1/s1 |
| InChIKey | YOUZLUOCAMUMNW-SSDOTTSWSA-N |
| XLogP | 0.41 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|