C12H23N3O4 — CID 47454097
ethyl 2-[[2-(methylcarbamoylamino)-2-oxoethyl]-(2-methylpropyl)amino]acetate (PubChem CID 47454097) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is ethyl 2-[[2-(methylcarbamoylamino)-2-oxoethyl]-(2-methylpropyl)amino]acetate.
| Compound Name | ethyl 2-[[2-(methylcarbamoylamino)-2-oxoethyl]-(2-methylpropyl)amino]acetate |
|---|---|
| PubChem CID | 47454097 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl 2-[[2-(methylcarbamoylamino)-2-oxoethyl]-(2-methylpropyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC(=O)NC(=O)NC)CC(C)C |
| InChI | InChI=1S/C12H23N3O4/c1-5-19-11(17)8-15(6-9(2)3)7-10(16)14-12(18)13-4/h9H,5-8H2,1-4H3,(H2,13,14,16,18) |
| InChIKey | KKKWAPFENXFYAY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |