C15H25N3OS — CID 47455518
3-cyclooctyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]urea (PubChem CID 47455518) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 3-cyclooctyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]urea.
| Compound Name | 3-cyclooctyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 47455518 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-cyclooctyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]urea |
| SMILES | Cc1nc(CN(C)C(=O)NC2CCCCCCC2)cs1 |
| InChI | InChI=1S/C15H25N3OS/c1-12-16-14(11-20-12)10-18(2)15(19)17-13-8-6-4-3-5-7-9-13/h11,13H,3-10H2,1-2H3,(H,17,19) |
| InChIKey | BKIHNXJSWAKBNC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |