C9H21N3O3S — CID 47464795
N-tert-butyl-2-(dimethylsulfamoylamino)propanamide (PubChem CID 47464795) has the molecular formula C9H21N3O3S and a molecular weight of 251.35 g/mol. Its IUPAC name is N-tert-butyl-2-(dimethylsulfamoylamino)propanamide.
| Compound Name | N-tert-butyl-2-(dimethylsulfamoylamino)propanamide |
|---|---|
| PubChem CID | 47464795 |
| Molecular Formula | C9H21N3O3S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-tert-butyl-2-(dimethylsulfamoylamino)propanamide |
| SMILES | CC(NS(=O)(=O)N(C)C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H21N3O3S/c1-7(8(13)10-9(2,3)4)11-16(14,15)12(5)6/h7,11H,1-6H3,(H,10,13) |
| InChIKey | OIQGQMMVVPWRPU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |