C13H16N4OS — CID 47476509
3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-2-one (PubChem CID 47476509) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-2-one.
| Compound Name | 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 47476509 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-2-one |
| SMILES | CCc1cc2c(NC3CCCNC3=O)ncnc2s1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-8-6-9-11(15-7-16-13(9)19-8)17-10-4-3-5-14-12(10)18/h6-7,10H,2-5H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | JUFMSKMXFBCFLG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |