C15H21N3OS — CID 133399232
6-ethyl-N-(3-methoxycyclohexyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 133399232) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 6-ethyl-N-(3-methoxycyclohexyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-(3-methoxycyclohexyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133399232 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 6-ethyl-N-(3-methoxycyclohexyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCc1cc2c(NC3CCCC(OC)C3)ncnc2s1 |
| InChI | InChI=1S/C15H21N3OS/c1-3-12-8-13-14(16-9-17-15(13)20-12)18-10-5-4-6-11(7-10)19-2/h8-11H,3-7H2,1-2H3,(H,16,17,18) |
| InChIKey | DQFVFQJIBHHVEM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |