C16H19F3N4O3S — CID 146636188
[(1R,3S,5S)-3-methoxy-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid (PubChem CID 146636188) has the molecular formula C16H19F3N4O3S and a molecular weight of 404.41 g/mol. Its IUPAC name is [(1R,3S,5S)-3-methoxy-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid.
| Compound Name | [(1R,3S,5S)-3-methoxy-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 146636188 |
| Molecular Formula | C16H19F3N4O3S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [(1R,3S,5S)-3-methoxy-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
| SMILES | CO[C@@H]1C[C@H](NC(=O)O)C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C16H19F3N4O3S/c1-26-10-3-8(2-9(4-10)23-15(24)25)22-13-12-5-11(6-16(17,18)19)27-14(12)21-7-20-13/h5,7-10,23H,2-4,6H2,1H3,(H,24,25)(H,20,21,22)/t8-,9+,10-/m0/s1 |
| InChIKey | PNXKZEYCICAMNC-AEJSXWLSSA-N |
| XLogP | 3.41 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |