C24H25ClF3N5OS — CID 157022358
cis-(1R,3S)-3-N-[[4-(1,3-oxazol-2-yl)phenyl]methyl]-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine;hydrochloride (PubChem CID 157022358) has the molecular formula C24H25ClF3N5OS and a molecular weight of 524.01 g/mol. Its IUPAC name is cis-(1R,3S)-3-N-[[4-(1,3-oxazol-2-yl)phenyl]methyl]-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine;hydrochloride.
| Compound Name | cis-(1R,3S)-3-N-[[4-(1,3-oxazol-2-yl)phenyl]methyl]-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 157022358 |
| Molecular Formula | C24H25ClF3N5OS |
| Molecular Weight | 524.01 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | cis-(1R,3S)-3-N-[[4-(1,3-oxazol-2-yl)phenyl]methyl]-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine;hydrochloride |
| SMILES | Cl.FC(F)(F)Cc1cc2c(N[C@@H]3CCC[C@H](NCc4ccc(-c5ncco5)cc4)C3)ncnc2s1 |
| InChI | InChI=1S/C24H24F3N5OS.ClH/c25-24(26,27)12-19-11-20-21(30-14-31-23(20)34-19)32-18-3-1-2-17(10-18)29-13-15-4-6-16(7-5-15)22-28-8-9-33-22;/h4-9,11,14,17-18,29H,1-3,10,12-13H2,(H,30,31,32);1H/t17-,18+;/m0./s1 |
| InChIKey | HBVGONAWGYHMNM-CJRXIRLBSA-N |
| XLogP | 6.39 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.01 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |