C27H34F3N5S — CID 90455048
(3S,4S)-1-benzyl-3-N-(2-cyclopentylethyl)-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidine-3,4-diamine (PubChem CID 90455048) has the molecular formula C27H34F3N5S and a molecular weight of 517.67 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-N-(2-cyclopentylethyl)-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidine-3,4-diamine.
| Compound Name | (3S,4S)-1-benzyl-3-N-(2-cyclopentylethyl)-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidine-3,4-diamine |
|---|---|
| PubChem CID | 90455048 |
| Molecular Formula | C27H34F3N5S |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (3S,4S)-1-benzyl-3-N-(2-cyclopentylethyl)-4-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperidine-3,4-diamine |
| SMILES | FC(F)(F)Cc1cc2c(N[C@H]3CCN(Cc4ccccc4)C[C@@H]3NCCC3CCCC3)ncnc2s1 |
| InChI | InChI=1S/C27H34F3N5S/c28-27(29,30)15-21-14-22-25(32-18-33-26(22)36-21)34-23-11-13-35(16-20-8-2-1-3-9-20)17-24(23)31-12-10-19-6-4-5-7-19/h1-3,8-9,14,18-19,23-24,31H,4-7,10-13,15-17H2,(H,32,33,34)/t23-,24-/m0/s1 |
| InChIKey | YAOJQAKMXZNCEQ-ZEQRLZLVSA-N |
| XLogP | 6.02 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |