C14H17F3N4S — CID 151424092
cis-(1R,3S)-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine (PubChem CID 151424092) has the molecular formula C14H17F3N4S and a molecular weight of 330.38 g/mol. Its IUPAC name is cis-(1R,3S)-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine.
| Compound Name | cis-(1R,3S)-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 151424092 |
| Molecular Formula | C14H17F3N4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | cis-(1R,3S)-1-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
| SMILES | N[C@H]1CCC[C@@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C14H17F3N4S/c15-14(16,17)6-10-5-11-12(19-7-20-13(11)22-10)21-9-3-1-2-8(18)4-9/h5,7-9H,1-4,6,18H2,(H,19,20,21)/t8-,9+/m0/s1 |
| InChIKey | PBDQTOUHOHTMBP-DTWKUNHWSA-N |
| XLogP | 3.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |