C16H21F3N4S — CID 146669941
1-N-[2,7-dimethylidene-9-(2,2,2-trifluoroethyl)-1,3,5-thiadiazonin-6-yl]cyclohexane-1,3-diamine (PubChem CID 146669941) has the molecular formula C16H21F3N4S and a molecular weight of 358.43 g/mol. Its IUPAC name is 1-N-[2,7-dimethylidene-9-(2,2,2-trifluoroethyl)-1,3,5-thiadiazonin-6-yl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[2,7-dimethylidene-9-(2,2,2-trifluoroethyl)-1,3,5-thiadiazonin-6-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 146669941 |
| Molecular Formula | C16H21F3N4S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-N-[2,7-dimethylidene-9-(2,2,2-trifluoroethyl)-1,3,5-thiadiazonin-6-yl]cyclohexane-1,3-diamine |
| SMILES | C=c1ncnc(NC2CCCC(N)C2)c(=C)cc(CC(F)(F)F)s1 |
| InChI | InChI=1S/C16H21F3N4S/c1-10-6-14(8-16(17,18)19)24-11(2)21-9-22-15(10)23-13-5-3-4-12(20)7-13/h6,9,12-13H,1-5,7-8,20H2,(H,21,22,23)/b14-6- |
| InChIKey | WJAYMBHZHXTLFF-NSIKDUERSA-N |
| XLogP | 2.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |