C30H36F3N5O2S — CID 146670213
cis-(3S,5R)-5-ethoxy-1-N-[[4-(5-methoxy-5-methyl-4H-pyridin-3-yl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine (PubChem CID 146670213) has the molecular formula C30H36F3N5O2S and a molecular weight of 587.71 g/mol. Its IUPAC name is cis-(3S,5R)-5-ethoxy-1-N-[[4-(5-methoxy-5-methyl-4H-pyridin-3-yl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine.
| Compound Name | cis-(3S,5R)-5-ethoxy-1-N-[[4-(5-methoxy-5-methyl-4H-pyridin-3-yl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 146670213 |
| Molecular Formula | C30H36F3N5O2S |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | cis-(3S,5R)-5-ethoxy-1-N-[[4-(5-methoxy-5-methyl-4H-pyridin-3-yl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
| SMILES | CCO[C@@H]1CC(NCc2ccc(C3=CN=CC(C)(OC)C3)cc2)C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C30H36F3N5O2S/c1-4-40-24-10-22(35-15-19-5-7-20(8-6-19)21-13-29(2,39-3)17-34-16-21)9-23(11-24)38-27-26-12-25(14-30(31,32)33)41-28(26)37-18-36-27/h5-8,12,16-18,22-24,35H,4,9-11,13-15H2,1-3H3,(H,36,37,38)/t22?,23-,24+,29?/m0/s1 |
| InChIKey | TXOAENOBIKUQIP-WBGUQPIESA-N |
| XLogP | 6.54 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |