C27H27ClF3N5O2S — CID 170942909
(1R,2S,4R)-4-[[4-(6-chloro-5-methoxy-3-pyridinyl)phenyl]methylamino]-2-[[2-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol (PubChem CID 170942909) has the molecular formula C27H27ClF3N5O2S and a molecular weight of 578.06 g/mol. Its IUPAC name is (1R,2S,4R)-4-[[4-(6-chloro-5-methoxy-3-pyridinyl)phenyl]methylamino]-2-[[2-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-4-[[4-(6-chloro-5-methoxy-3-pyridinyl)phenyl]methylamino]-2-[[2-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 170942909 |
| Molecular Formula | C27H27ClF3N5O2S |
| Molecular Weight | 578.06 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | (1R,2S,4R)-4-[[4-(6-chloro-5-methoxy-3-pyridinyl)phenyl]methylamino]-2-[[2-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
| SMILES | COc1cc(-c2ccc(CN[C@H]3C[C@@H](O)[C@@H](Nc4nc(C)nc5sc(CC(F)(F)F)cc45)C3)cc2)cnc1Cl |
| InChI | InChI=1S/C27H27ClF3N5O2S/c1-14-34-25(20-10-19(11-27(29,30)31)39-26(20)35-14)36-21-8-18(9-22(21)37)32-12-15-3-5-16(6-4-15)17-7-23(38-2)24(28)33-13-17/h3-7,10,13,18,21-22,32,37H,8-9,11-12H2,1-2H3,(H,34,35,36)/t18-,21+,22-/m1/s1 |
| InChIKey | RFRPFJAASRWWQT-BVYCBKJFSA-N |
| XLogP | 5.92 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|