C29H32F3N5O5S2 — CID 157022308
(1R,2S,4R)-4-[[4-(5-methoxy-6-methylsulfonyl-3-pyridinyl)phenyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol (PubChem CID 157022308) has the molecular formula C29H32F3N5O5S2 and a molecular weight of 651.73 g/mol. Its IUPAC name is (1R,2S,4R)-4-[[4-(5-methoxy-6-methylsulfonyl-3-pyridinyl)phenyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-4-[[4-(5-methoxy-6-methylsulfonyl-3-pyridinyl)phenyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 157022308 |
| Molecular Formula | C29H32F3N5O5S2 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.18 |
| IUPAC Name | (1R,2S,4R)-4-[[4-(5-methoxy-6-methylsulfonyl-3-pyridinyl)phenyl]methylamino]-2-[[2-methoxy-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]cyclopentan-1-ol |
| SMILES | COc1nc(N(C)[C@H]2C[C@@H](NCc3ccc(-c4cnc(S(C)(=O)=O)c(OC)c4)cc3)C[C@H]2O)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C29H32F3N5O5S2/c1-37(25-21-12-20(13-29(30,31)32)43-26(21)36-28(35-25)42-3)22-10-19(11-23(22)38)33-14-16-5-7-17(8-6-16)18-9-24(41-2)27(34-15-18)44(4,39)40/h5-9,12,15,19,22-23,33,38H,10-11,13-14H2,1-4H3/t19-,22+,23-/m1/s1 |
| InChIKey | PWEQEEOWQADXIN-WTIAFYNJSA-N |
| XLogP | 4.40 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |