C28H31ClF3N5O2S — CID 157022379
(1R,2S,4R)-4-[[4-(5-methoxy-6-methyl-3-pyridinyl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol;hydrochloride (PubChem CID 157022379) has the molecular formula C28H31ClF3N5O2S and a molecular weight of 594.10 g/mol. Its IUPAC name is (1R,2S,4R)-4-[[4-(5-methoxy-6-methyl-3-pyridinyl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol;hydrochloride.
| Compound Name | (1R,2S,4R)-4-[[4-(5-methoxy-6-methyl-3-pyridinyl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 157022379 |
| Molecular Formula | C28H31ClF3N5O2S |
| Molecular Weight | 594.10 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | (1R,2S,4R)-4-[[4-(5-methoxy-6-methyl-3-pyridinyl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol;hydrochloride |
| SMILES | COc1cc(-c2ccc(CN[C@H]3C[C@@H](O)[C@@H](N(C)c4ncnc5sc(CC(F)(F)F)cc45)C3)cc2)cnc1C.Cl |
| InChI | InChI=1S/C28H30F3N5O2S.ClH/c1-16-25(38-3)8-19(14-32-16)18-6-4-17(5-7-18)13-33-20-9-23(24(37)10-20)36(2)26-22-11-21(12-28(29,30)31)39-27(22)35-15-34-26;/h4-8,11,14-15,20,23-24,33,37H,9-10,12-13H2,1-3H3;1H/t20-,23+,24-;/m1./s1 |
| InChIKey | IYXQLLJAKAKQDR-HGSHJSECSA-N |
| XLogP | 5.71 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.10 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |