C15H18ClF3N4OS — CID 146669572
(1R,2S,4R)-2-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-(methylamino)cyclopentan-1-ol (PubChem CID 146669572) has the molecular formula C15H18ClF3N4OS and a molecular weight of 394.85 g/mol. Its IUPAC name is (1R,2S,4R)-2-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-(methylamino)cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-2-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-(methylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 146669572 |
| Molecular Formula | C15H18ClF3N4OS |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (1R,2S,4R)-2-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-(methylamino)cyclopentan-1-ol |
| SMILES | CN[C@H]1C[C@@H](O)[C@@H](N(C)c2nc(Cl)nc3sc(CC(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C15H18ClF3N4OS/c1-20-7-3-10(11(24)4-7)23(2)12-9-5-8(6-15(17,18)19)25-13(9)22-14(16)21-12/h5,7,10-11,20,24H,3-4,6H2,1-2H3/t7-,10+,11-/m1/s1 |
| InChIKey | NDGJMSULIFXMOZ-PPKCKEKNSA-N |
| XLogP | 3.00 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |