C22H22ClF3N4O3S — CID 146670029
benzyl N-[(1R,3S,4R)-3-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-hydroxycyclopentyl]carbamate (PubChem CID 146670029) has the molecular formula C22H22ClF3N4O3S and a molecular weight of 514.96 g/mol. Its IUPAC name is benzyl N-[(1R,3S,4R)-3-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-hydroxycyclopentyl]carbamate.
| Compound Name | benzyl N-[(1R,3S,4R)-3-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-hydroxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 146670029 |
| Molecular Formula | C22H22ClF3N4O3S |
| Molecular Weight | 514.96 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | benzyl N-[(1R,3S,4R)-3-[[2-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-methylamino]-4-hydroxycyclopentyl]carbamate |
| SMILES | CN(c1nc(Cl)nc2sc(CC(F)(F)F)cc12)[C@H]1C[C@@H](NC(=O)OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C22H22ClF3N4O3S/c1-30(18-15-9-14(10-22(24,25)26)34-19(15)29-20(23)28-18)16-7-13(8-17(16)31)27-21(32)33-11-12-5-3-2-4-6-12/h2-6,9,13,16-17,31H,7-8,10-11H2,1H3,(H,27,32)/t13-,16+,17-/m1/s1 |
| InChIKey | QBDSVZJKVALBCU-XOKHGSTOSA-N |
| XLogP | 4.70 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |