C33H48N4O8 — CID 158931649
benzyl N-[(1R,3S,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate;tert-butyl N-[(1S,2S,4R)-2-hydroxy-4-(phenylmethoxycarbonylamino)cyclopentyl]-N-methylcarbamate (PubChem CID 158931649) has the molecular formula C33H48N4O8 and a molecular weight of 628.77 g/mol. Its IUPAC name is benzyl N-[(1R,3S,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate;tert-butyl N-[(1S,2S,4R)-2-hydroxy-4-(phenylmethoxycarbonylamino)cyclopentyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(1R,3S,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate;tert-butyl N-[(1S,2S,4R)-2-hydroxy-4-(phenylmethoxycarbonylamino)cyclopentyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 158931649 |
| Molecular Formula | C33H48N4O8 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | benzyl N-[(1R,3S,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate;tert-butyl N-[(1S,2S,4R)-2-hydroxy-4-(phenylmethoxycarbonylamino)cyclopentyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1C[C@@H](NC(=O)OCc2ccccc2)C[C@@H]1O.CN[C@H]1C[C@@H](NC(=O)OCc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C19H28N2O5.C14H20N2O3/c1-19(2,3)26-18(24)21(4)15-10-14(11-16(15)22)20-17(23)25-12-13-8-6-5-7-9-13;1-15-12-7-11(8-13(12)17)16-14(18)19-9-10-5-3-2-4-6-10/h5-9,14-16,22H,10-12H2,1-4H3,(H,20,23);2-6,11-13,15,17H,7-9H2,1H3,(H,16,18)/t14-,15+,16+;11-,12+,13+/m11/s1 |
| InChIKey | JJDFYEHVGNDJPK-UVWDPYPUSA-N |
| XLogP | 3.70 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|