C23H46N4O6 — CID 159804213
tert-butyl N-[(1R,3S,4R)-3-(dimethylamino)-4-hydroxycyclopentyl]carbamate;tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate (PubChem CID 159804213) has the molecular formula C23H46N4O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S,4R)-3-(dimethylamino)-4-hydroxycyclopentyl]carbamate;tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S,4R)-3-(dimethylamino)-4-hydroxycyclopentyl]carbamate;tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 159804213 |
| Molecular Formula | C23H46N4O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | tert-butyl N-[(1R,3S,4R)-3-(dimethylamino)-4-hydroxycyclopentyl]carbamate;tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate |
| SMILES | CN(C)[C@H]1C[C@@H](NC(=O)OC(C)(C)C)C[C@H]1O.CN[C@H]1C[C@@H](NC(=O)OC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C12H24N2O3.C11H22N2O3/c1-12(2,3)17-11(16)13-8-6-9(14(4)5)10(15)7-8;1-11(2,3)16-10(15)13-7-5-8(12-4)9(14)6-7/h8-10,15H,6-7H2,1-5H3,(H,13,16);7-9,12,14H,5-6H2,1-4H3,(H,13,15)/t8-,9+,10-;7-,8+,9-/m11/s1 |
| InChIKey | NKELFFAIQBRXFG-MNOXLVIHSA-N |
| XLogP | 1.59 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |