C23H26F3N5O3S — CID 150358553
benzyl N-[(1R,3S,4S)-3-hydroxy-4-[methyl-[2-(methylamino)-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamate (PubChem CID 150358553) has the molecular formula C23H26F3N5O3S and a molecular weight of 509.55 g/mol. Its IUPAC name is benzyl N-[(1R,3S,4S)-3-hydroxy-4-[methyl-[2-(methylamino)-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamate.
| Compound Name | benzyl N-[(1R,3S,4S)-3-hydroxy-4-[methyl-[2-(methylamino)-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 150358553 |
| Molecular Formula | C23H26F3N5O3S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | benzyl N-[(1R,3S,4S)-3-hydroxy-4-[methyl-[2-(methylamino)-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentyl]carbamate |
| SMILES | CNc1nc(N(C)[C@H]2C[C@@H](NC(=O)OCc3ccccc3)C[C@@H]2O)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C23H26F3N5O3S/c1-27-21-29-19(16-10-15(11-23(24,25)26)35-20(16)30-21)31(2)17-8-14(9-18(17)32)28-22(33)34-12-13-6-4-3-5-7-13/h3-7,10,14,17-18,32H,8-9,11-12H2,1-2H3,(H,28,33)(H,27,29,30)/t14-,17+,18+/m1/s1 |
| InChIKey | GVFXSNUGTCSMKQ-JLSDUUJJSA-N |
| XLogP | 4.09 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |