C23H26F3N5S — CID 138497714
4-(2-benzyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine (PubChem CID 138497714) has the molecular formula C23H26F3N5S and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-(2-benzyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(2-benzyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 138497714 |
| Molecular Formula | C23H26F3N5S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-(2-benzyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl)-N-methyl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-2-amine |
| SMILES | CNc1nc(N2CCC3CN(Cc4ccccc4)CC3C2)c2cc(CC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C23H26F3N5S/c1-27-22-28-20(19-9-18(10-23(24,25)26)32-21(19)29-22)31-8-7-16-12-30(13-17(16)14-31)11-15-5-3-2-4-6-15/h2-6,9,16-17H,7-8,10-14H2,1H3,(H,27,28,29) |
| InChIKey | FTRNIGLUXGVFSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |