C28H26ClF3N6OS — CID 157022261
(1R,2S,4R)-4-[[4-(4-chloro-1H-pyrrolo[3,2-c]pyridin-7-yl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol (PubChem CID 157022261) has the molecular formula C28H26ClF3N6OS and a molecular weight of 587.07 g/mol. Its IUPAC name is (1R,2S,4R)-4-[[4-(4-chloro-1H-pyrrolo[3,2-c]pyridin-7-yl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-4-[[4-(4-chloro-1H-pyrrolo[3,2-c]pyridin-7-yl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 157022261 |
| Molecular Formula | C28H26ClF3N6OS |
| Molecular Weight | 587.07 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | (1R,2S,4R)-4-[[4-(4-chloro-1H-pyrrolo[3,2-c]pyridin-7-yl)phenyl]methylamino]-2-[methyl-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
| SMILES | CN(c1ncnc2sc(CC(F)(F)F)cc12)[C@H]1C[C@@H](NCc2ccc(-c3cnc(Cl)c4cc[nH]c34)cc2)C[C@H]1O |
| InChI | InChI=1S/C28H26ClF3N6OS/c1-38(26-20-10-18(11-28(30,31)32)40-27(20)37-14-36-26)22-8-17(9-23(22)39)34-12-15-2-4-16(5-3-15)21-13-35-25(29)19-6-7-33-24(19)21/h2-7,10,13-14,17,22-23,33-34,39H,8-9,11-12H2,1H3/t17-,22+,23-/m1/s1 |
| InChIKey | GEYVHBNTMASRPB-MQNAVGNWSA-N |
| XLogP | 6.11 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.07 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|